C11H14F2N2O3 — CID 114094437
N-(2,6-dioxopiperidin-3-yl)-3,3-difluorocyclopentane-1-carboxamide (PubChem CID 114094437) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3,3-difluorocyclopentane-1-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3,3-difluorocyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 114094437 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3,3-difluorocyclopentane-1-carboxamide |
| SMILES | O=C1CCC(NC(=O)C2CCC(F)(F)C2)C(=O)N1 |
| InChI | InChI=1S/C11H14F2N2O3/c12-11(13)4-3-6(5-11)9(17)14-7-1-2-8(16)15-10(7)18/h6-7H,1-5H2,(H,14,17)(H,15,16,18) |
| InChIKey | PRKKJISPKXLKBB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|