C12H11FN2O4 — CID 167480210
(4-fluorophenyl) N-(2,6-dioxopiperidin-3-yl)carbamate (PubChem CID 167480210) has the molecular formula C12H11FN2O4 and a molecular weight of 266.23 g/mol. Its IUPAC name is (4-fluorophenyl) N-(2,6-dioxopiperidin-3-yl)carbamate.
| Compound Name | (4-fluorophenyl) N-(2,6-dioxopiperidin-3-yl)carbamate |
|---|---|
| PubChem CID | 167480210 |
| Molecular Formula | C12H11FN2O4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (4-fluorophenyl) N-(2,6-dioxopiperidin-3-yl)carbamate |
| SMILES | O=C1CCC(NC(=O)Oc2ccc(F)cc2)C(=O)N1 |
| InChI | InChI=1S/C12H11FN2O4/c13-7-1-3-8(4-2-7)19-12(18)14-9-5-6-10(16)15-11(9)17/h1-4,9H,5-6H2,(H,14,18)(H,15,16,17) |
| InChIKey | PGTUFILOXWEBIC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|