C14H13FN2O3 — CID 77109535
N-(2,6-dioxopiperidin-3-yl)-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 77109535) has the molecular formula C14H13FN2O3 and a molecular weight of 276.27 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 77109535 |
| Molecular Formula | C14H13FN2O3 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H13FN2O3/c15-10-4-1-9(2-5-10)3-7-12(18)16-11-6-8-13(19)17-14(11)20/h1-5,7,11H,6,8H2,(H,16,18)(H,17,19,20) |
| InChIKey | HQCHRJXCCRSYIQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|