C9H12N2O3 — CID 65439330
N-(2,6-dioxopiperidin-3-yl)but-3-enamide (PubChem CID 65439330) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)but-3-enamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)but-3-enamide |
|---|---|
| PubChem CID | 65439330 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)but-3-enamide |
| SMILES | C=CCC(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C9H12N2O3/c1-2-3-7(12)10-6-4-5-8(13)11-9(6)14/h2,6H,1,3-5H2,(H,10,12)(H,11,13,14) |
| InChIKey | OKUVEKSMPMEAPT-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|