C9H15N3O4 — CID 79478388
2-(2-aminoethoxy)-N-(2,6-dioxopiperidin-3-yl)acetamide (PubChem CID 79478388) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(2,6-dioxopiperidin-3-yl)acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-(2,6-dioxopiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 79478388 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(2,6-dioxopiperidin-3-yl)acetamide |
| SMILES | NCCOCC(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C9H15N3O4/c10-3-4-16-5-8(14)11-6-1-2-7(13)12-9(6)15/h6H,1-5,10H2,(H,11,14)(H,12,13,15) |
| InChIKey | ZYUTZGYPDKYJIO-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|