C10H18N2O3S — CID 166478743
ethane;S-ethyl N-(2,6-dioxopiperidin-3-yl)carbamothioate (PubChem CID 166478743) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is ethane;S-ethyl N-(2,6-dioxopiperidin-3-yl)carbamothioate.
| Compound Name | ethane;S-ethyl N-(2,6-dioxopiperidin-3-yl)carbamothioate |
|---|---|
| PubChem CID | 166478743 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | ethane;S-ethyl N-(2,6-dioxopiperidin-3-yl)carbamothioate |
| SMILES | CC.CCSC(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C8H12N2O3S.C2H6/c1-2-14-8(13)9-5-3-4-6(11)10-7(5)12;1-2/h5H,2-4H2,1H3,(H,9,13)(H,10,11,12);1-2H3 |
| InChIKey | CIVSLUHNQJLRNP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|