C9H13N3O6 — CID 114007600
(2S)-3-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-2-hydroxypropanoic acid (PubChem CID 114007600) has the molecular formula C9H13N3O6 and a molecular weight of 259.22 g/mol. Its IUPAC name is (2S)-3-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 114007600 |
| Molecular Formula | C9H13N3O6 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (2S)-3-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-2-hydroxypropanoic acid |
| SMILES | O=C1CCC(NC(=O)NC[C@H](O)C(=O)O)C(=O)N1 |
| InChI | InChI=1S/C9H13N3O6/c13-5(8(16)17)3-10-9(18)11-4-1-2-6(14)12-7(4)15/h4-5,13H,1-3H2,(H,16,17)(H2,10,11,18)(H,12,14,15)/t4?,5-/m0/s1 |
| InChIKey | WGVNOKKLHDXMQH-AKGZTFGVSA-N |
| XLogP | -2.46 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|