C10H15N3O6 — CID 114005723
(2R)-2-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 114005723) has the molecular formula C10H15N3O6 and a molecular weight of 273.25 g/mol. Its IUPAC name is (2R)-2-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114005723 |
| Molecular Formula | C10H15N3O6 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2R)-2-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | O=C1CCC(NC(=O)N[C@H](CCO)C(=O)O)C(=O)N1 |
| InChI | InChI=1S/C10H15N3O6/c14-4-3-6(9(17)18)12-10(19)11-5-1-2-7(15)13-8(5)16/h5-6,14H,1-4H2,(H,17,18)(H2,11,12,19)(H,13,15,16)/t5?,6-/m1/s1 |
| InChIKey | JCIJVVCZQRTILE-PRJDIBJQSA-N |
| XLogP | -2.07 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|