C10H16N2O4 — CID 107829012
(2R)-2-(cyclopent-3-en-1-ylcarbamoylamino)-4-hydroxybutanoic acid (PubChem CID 107829012) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is (2R)-2-(cyclopent-3-en-1-ylcarbamoylamino)-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-(cyclopent-3-en-1-ylcarbamoylamino)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107829012 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2R)-2-(cyclopent-3-en-1-ylcarbamoylamino)-4-hydroxybutanoic acid |
| SMILES | O=C(NC1CC=CC1)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c13-6-5-8(9(14)15)12-10(16)11-7-3-1-2-4-7/h1-2,7-8,13H,3-6H2,(H,14,15)(H2,11,12,16)/t8-/m1/s1 |
| InChIKey | VYNMAAHLWYUBJX-MRVPVSSYSA-N |
| XLogP | -0.16 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|