C10H15N3O6 — CID 104966371
(2S,3R)-2-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-hydroxybutanoic acid (PubChem CID 104966371) has the molecular formula C10H15N3O6 and a molecular weight of 273.25 g/mol. Its IUPAC name is (2S,3R)-2-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104966371 |
| Molecular Formula | C10H15N3O6 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2S,3R)-2-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)NC1CCC(=O)NC1=O)C(=O)O |
| InChI | InChI=1S/C10H15N3O6/c1-4(14)7(9(17)18)13-10(19)11-5-2-3-6(15)12-8(5)16/h4-5,7,14H,2-3H2,1H3,(H,17,18)(H2,11,13,19)(H,12,15,16)/t4-,5?,7+/m1/s1 |
| InChIKey | RTEMDTKZPGGDDT-XWGOABOUSA-N |
| XLogP | -2.08 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|