C11H17N3O6 — CID 104966378
(2S,3R)-2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxybutanoic acid (PubChem CID 104966378) has the molecular formula C11H17N3O6 and a molecular weight of 287.27 g/mol. Its IUPAC name is (2S,3R)-2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104966378 |
| Molecular Formula | C11H17N3O6 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (2S,3R)-2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxybutanoic acid |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C11H17N3O6/c1-3-6-9(17)12-7(16)4-14(6)11(20)13-8(5(2)15)10(18)19/h5-6,8,15H,3-4H2,1-2H3,(H,13,20)(H,18,19)(H,12,16,17)/t5-,6?,8+/m1/s1 |
| InChIKey | DULCFIVGKLOXRP-UHFKNVDDSA-N |
| XLogP | -1.73 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|