C12H19N3O5S — CID 66068025
(2S)-2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 66068025) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is (2S)-2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 66068025 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (2S)-2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)N[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C12H19N3O5S/c1-3-8-10(17)14-9(16)6-15(8)12(20)13-7(11(18)19)4-5-21-2/h7-8H,3-6H2,1-2H3,(H,13,20)(H,18,19)(H,14,16,17)/t7-,8?/m0/s1 |
| InChIKey | ZUYRSTZAYLOOTI-JAMMHHFISA-N |
| XLogP | -0.36 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|