C11H18N2O3S — CID 114411644
2-(3,6-dihydro-2H-pyridine-1-carbonylamino)-4-methylsulfanylbutanoic acid (PubChem CID 114411644) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyridine-1-carbonylamino)-4-methylsulfanylbutanoic acid.
| Compound Name | 2-(3,6-dihydro-2H-pyridine-1-carbonylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 114411644 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyridine-1-carbonylamino)-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)N1CC=CCC1)C(=O)O |
| InChI | InChI=1S/C11H18N2O3S/c1-17-8-5-9(10(14)15)12-11(16)13-6-3-2-4-7-13/h2-3,9H,4-8H2,1H3,(H,12,16)(H,14,15) |
| InChIKey | RJXXNZBWTIQTFF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|