C10H18N2O4S — CID 104910273
(2R)-2-[(3-hydroxypyrrolidine-1-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 104910273) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is (2R)-2-[(3-hydroxypyrrolidine-1-carbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(3-hydroxypyrrolidine-1-carbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104910273 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (2R)-2-[(3-hydroxypyrrolidine-1-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)N1CCC(O)C1)C(=O)O |
| InChI | InChI=1S/C10H18N2O4S/c1-17-5-3-8(9(14)15)11-10(16)12-4-2-7(13)6-12/h7-8,13H,2-6H2,1H3,(H,11,16)(H,14,15)/t7?,8-/m1/s1 |
| InChIKey | ZWNWTMVXTROQHZ-BRFYHDHCSA-N |
| XLogP | -0.03 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |