C13H23N3O3S — CID 104910450
(2R)-2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonylamino)-4-methylsulfanylbutanoic acid (PubChem CID 104910450) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is (2R)-2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonylamino)-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104910450 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2R)-2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonylamino)-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)N1CCN2CCCC2C1)C(=O)O |
| InChI | InChI=1S/C13H23N3O3S/c1-20-8-4-11(12(17)18)14-13(19)16-7-6-15-5-2-3-10(15)9-16/h10-11H,2-9H2,1H3,(H,14,19)(H,17,18)/t10?,11-/m1/s1 |
| InChIKey | LHCRUARQFDOKEI-RRKGBCIJSA-N |
| XLogP | 0.68 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |