C13H21N3O4S — CID 104910523
(2R)-4-methylsulfanyl-2-[(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl)amino]butanoic acid (PubChem CID 104910523) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-[(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl)amino]butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-[(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 104910523 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-[(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl)amino]butanoic acid |
| SMILES | CSCC[C@@H](NC(=O)N1CCN2C(=O)CCC2C1)C(=O)O |
| InChI | InChI=1S/C13H21N3O4S/c1-21-7-4-10(12(18)19)14-13(20)15-5-6-16-9(8-15)2-3-11(16)17/h9-10H,2-8H2,1H3,(H,14,20)(H,18,19)/t9?,10-/m1/s1 |
| InChIKey | NAXVZNOBRNXOQC-QVDQXJPCSA-N |
| XLogP | 0.21 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |