C14H25N3O3S — CID 79931671
(2S)-2-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 79931671) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is (2S)-2-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 79931671 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (2S)-2-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)N1CC2CCCN2CC1C)C(=O)O |
| InChI | InChI=1S/C14H25N3O3S/c1-10-8-16-6-3-4-11(16)9-17(10)14(20)15-12(13(18)19)5-7-21-2/h10-12H,3-9H2,1-2H3,(H,15,20)(H,18,19)/t10?,11?,12-/m0/s1 |
| InChIKey | ZGGUQXOTHHBSJL-MCIGGMRASA-N |
| XLogP | 1.07 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |