C13H23N3O4S — CID 104910015
(2R)-2-[[4-(methylcarbamoyl)piperidine-1-carbonyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 104910015) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is (2R)-2-[[4-(methylcarbamoyl)piperidine-1-carbonyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[4-(methylcarbamoyl)piperidine-1-carbonyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104910015 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2R)-2-[[4-(methylcarbamoyl)piperidine-1-carbonyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CNC(=O)C1CCN(C(=O)N[C@H](CCSC)C(=O)O)CC1 |
| InChI | InChI=1S/C13H23N3O4S/c1-14-11(17)9-3-6-16(7-4-9)13(20)15-10(12(18)19)5-8-21-2/h9-10H,3-8H2,1-2H3,(H,14,17)(H,15,20)(H,18,19)/t10-/m1/s1 |
| InChIKey | JJQQKKGBBPGREH-SNVBAGLBSA-N |
| XLogP | 0.36 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |