C11H18N2O3 — CID 107567733
(2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid (PubChem CID 107567733) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid.
| Compound Name | (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 107567733 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)N1CC=CCC1)C(=O)O |
| InChI | InChI=1S/C11H18N2O3/c1-2-6-9(10(14)15)12-11(16)13-7-4-3-5-8-13/h3-4,9H,2,5-8H2,1H3,(H,12,16)(H,14,15)/t9-/m1/s1 |
| InChIKey | NZKCPZITLANHFL-SECBINFHSA-N |
| XLogP | 1.21 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|