(2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid

C11H18N2O3 — CID 107567733

IUPAC(2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid
SMILESCCC[C@@H](NC(=O)N1CC=CCC1)C(=O)O
InChIInChI=1S/C11H18N2O3/c1-2-6-9(10(14)15)12-11(16)13-7-4-3-5-8-13/h3-4,9H,2,5-8H2,1H3,(H,12,16)(H,14,15)/t9-/m1/s1
InChIKeyNZKCPZITLANHFL-SECBINFHSA-N
MW226.28 g/mol
LogP1.21
Rot. Bonds4

About (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid

(2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid (PubChem CID 107567733) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid.

Molecular Properties

Compound Name(2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid
PubChem CID107567733
Molecular FormulaC11H18N2O3
Molecular Weight226.28 g/mol
Exact Mass226.13
IUPAC Name(2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid
SMILESCCC[C@@H](NC(=O)N1CC=CCC1)C(=O)O
InChIInChI=1S/C11H18N2O3/c1-2-6-9(10(14)15)12-11(16)13-7-4-3-5-8-13/h3-4,9H,2,5-8H2,1H3,(H,12,16)(H,14,15)/t9-/m1/s1
InChIKeyNZKCPZITLANHFL-SECBINFHSA-N
XLogP1.21
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.28
LogP ≤ 51.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid?
The IUPAC name of (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid (CID 107567733) is (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid.
What is the SMILES notation for (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid?
The canonical SMILES for (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid is CCC[C@@H](NC(=O)N1CC=CCC1)C(=O)O.
What is the InChIKey of (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid?
The InChIKey is NZKCPZITLANHFL-SECBINFHSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-2-6-9(10(14)15)12-11(16)13-7-4-3-5-8-13/h3-4,9H,2,5-8H2,1H3,(H,12,16)(H,14,15)/t9-/m1/s1.
What are the key properties of (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid?
(2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid has a molecular weight of 226.28 g/mol, XLogP of 1.21, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,6-dihydro-2H-pyridine-1-carbonylamino)pentanoic acid is sourced from PubChem (CID 107567733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).