C12H21N3O4 — CID 107566992
(2R)-2-[(2-ethyl-3-oxopiperazine-1-carbonyl)amino]pentanoic acid (PubChem CID 107566992) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2R)-2-[(2-ethyl-3-oxopiperazine-1-carbonyl)amino]pentanoic acid.
| Compound Name | (2R)-2-[(2-ethyl-3-oxopiperazine-1-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 107566992 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | (2R)-2-[(2-ethyl-3-oxopiperazine-1-carbonyl)amino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)N1CCNC(=O)C1CC)C(=O)O |
| InChI | InChI=1S/C12H21N3O4/c1-3-5-8(11(17)18)14-12(19)15-7-6-13-10(16)9(15)4-2/h8-9H,3-7H2,1-2H3,(H,13,16)(H,14,19)(H,17,18)/t8-,9?/m1/s1 |
| InChIKey | PFOYZJUOLXWFTB-VEDVMXKPSA-N |
| XLogP | 0.16 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |