C11H19N3O4 — CID 63607472
(2S)-3-methyl-2-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]butanoic acid (PubChem CID 63607472) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 63607472 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (2S)-3-methyl-2-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)N1CCNC(=O)C1C)C(=O)O |
| InChI | InChI=1S/C11H19N3O4/c1-6(2)8(10(16)17)13-11(18)14-5-4-12-9(15)7(14)3/h6-8H,4-5H2,1-3H3,(H,12,15)(H,13,18)(H,16,17)/t7?,8-/m0/s1 |
| InChIKey | KEOFQIKNWVDVIG-MQWKRIRWSA-N |
| XLogP | -0.37 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |