C11H18N4O5 — CID 107830881
(2R)-5-amino-2-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 107830881) has the molecular formula C11H18N4O5 and a molecular weight of 286.29 g/mol. Its IUPAC name is (2R)-5-amino-2-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107830881 |
| Molecular Formula | C11H18N4O5 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (2R)-5-amino-2-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | CC1C(=O)NCCN1C(=O)N[C@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H18N4O5/c1-6-9(17)13-4-5-15(6)11(20)14-7(10(18)19)2-3-8(12)16/h6-7H,2-5H2,1H3,(H2,12,16)(H,13,17)(H,14,20)(H,18,19)/t6?,7-/m1/s1 |
| InChIKey | PQCDPJPIBVKXJN-COBSHVIPSA-N |
| XLogP | -1.76 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |