C11H16N4O6 — CID 66076222
5-amino-2-[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 66076222) has the molecular formula C11H16N4O6 and a molecular weight of 300.27 g/mol. Its IUPAC name is 5-amino-2-[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 66076222 |
| Molecular Formula | C11H16N4O6 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-amino-2-[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H16N4O6/c1-5-9(18)14-8(17)4-15(5)11(21)13-6(10(19)20)2-3-7(12)16/h5-6H,2-4H2,1H3,(H2,12,16)(H,13,21)(H,19,20)(H,14,17,18) |
| InChIKey | ZRKNRWCSIYUYQF-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|