C10H16N4O5 — CID 61181984
5-amino-5-oxo-2-[(3-oxopiperazine-1-carbonyl)amino]pentanoic acid (PubChem CID 61181984) has the molecular formula C10H16N4O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-amino-5-oxo-2-[(3-oxopiperazine-1-carbonyl)amino]pentanoic acid.
| Compound Name | 5-amino-5-oxo-2-[(3-oxopiperazine-1-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 61181984 |
| Molecular Formula | C10H16N4O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 5-amino-5-oxo-2-[(3-oxopiperazine-1-carbonyl)amino]pentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)N1CCNC(=O)C1)C(=O)O |
| InChI | InChI=1S/C10H16N4O5/c11-7(15)2-1-6(9(17)18)13-10(19)14-4-3-12-8(16)5-14/h6H,1-5H2,(H2,11,15)(H,12,16)(H,13,19)(H,17,18) |
| InChIKey | RTTBMEGKTGXERK-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |