(2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid

C12H21N3O4 — CID 107146054

IUPAC(2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid
SMILESCCCC[C@H](NC(=O)N1CCNC(=O)CC1)C(=O)O
InChIInChI=1S/C12H21N3O4/c1-2-3-4-9(11(17)18)14-12(19)15-7-5-10(16)13-6-8-15/h9H,2-8H2,1H3,(H,13,16)(H,14,19)(H,17,18)/t9-/m0/s1
InChIKeyJURUPKUJEKZANF-VIFPVBQESA-N
MW271.32 g/mol
LogP0.16
Rot. Bonds5

About (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid

(2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid (PubChem CID 107146054) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid.

Molecular Properties

Compound Name(2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid
PubChem CID107146054
Molecular FormulaC12H21N3O4
Molecular Weight271.32 g/mol
Exact Mass271.15
IUPAC Name(2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid
SMILESCCCC[C@H](NC(=O)N1CCNC(=O)CC1)C(=O)O
InChIInChI=1S/C12H21N3O4/c1-2-3-4-9(11(17)18)14-12(19)15-7-5-10(16)13-6-8-15/h9H,2-8H2,1H3,(H,13,16)(H,14,19)(H,17,18)/t9-/m0/s1
InChIKeyJURUPKUJEKZANF-VIFPVBQESA-N
XLogP0.16
TPSA98.74 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.32
LogP ≤ 50.16
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid?
The IUPAC name of (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid (CID 107146054) is (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid.
What is the SMILES notation for (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid?
The canonical SMILES for (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid is CCCC[C@H](NC(=O)N1CCNC(=O)CC1)C(=O)O.
What is the InChIKey of (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid?
The InChIKey is JURUPKUJEKZANF-VIFPVBQESA-N. The full InChI is InChI=1S/C12H21N3O4/c1-2-3-4-9(11(17)18)14-12(19)15-7-5-10(16)13-6-8-15/h9H,2-8H2,1H3,(H,13,16)(H,14,19)(H,17,18)/t9-/m0/s1.
What are the key properties of (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid?
(2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid has a molecular weight of 271.32 g/mol, XLogP of 0.16, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(5-oxo-1,4-diazepane-1-carbonyl)amino]hexanoic acid is sourced from PubChem (CID 107146054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).