C8H13N3O4 — CID 61181300
2-[(3-oxopiperazine-1-carbonyl)amino]propanoic acid (PubChem CID 61181300) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-[(3-oxopiperazine-1-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(3-oxopiperazine-1-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 61181300 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-[(3-oxopiperazine-1-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)N1CCNC(=O)C1)C(=O)O |
| InChI | InChI=1S/C8H13N3O4/c1-5(7(13)14)10-8(15)11-3-2-9-6(12)4-11/h5H,2-4H2,1H3,(H,9,12)(H,10,15)(H,13,14) |
| InChIKey | LRSAVOQOAPFIIP-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |