C9H15N3O5 — CID 107839956
(2S)-2-hydroxy-3-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]propanoic acid (PubChem CID 107839956) has the molecular formula C9H15N3O5 and a molecular weight of 245.23 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 107839956 |
| Molecular Formula | C9H15N3O5 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | (2S)-2-hydroxy-3-[(2-methyl-3-oxopiperazine-1-carbonyl)amino]propanoic acid |
| SMILES | CC1C(=O)NCCN1C(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C9H15N3O5/c1-5-7(14)10-2-3-12(5)9(17)11-4-6(13)8(15)16/h5-6,13H,2-4H2,1H3,(H,10,14)(H,11,17)(H,15,16)/t5?,6-/m0/s1 |
| InChIKey | ZKZLTRCUOVZRJI-GDVGLLTNSA-N |
| XLogP | -2.04 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |