C13H24N4O3 — CID 63601168
[1-(2-ethyl-3-oxopiperazin-1-yl)-4-methyl-1-oxopentan-2-yl]urea (PubChem CID 63601168) has the molecular formula C13H24N4O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is [1-(2-ethyl-3-oxopiperazin-1-yl)-4-methyl-1-oxopentan-2-yl]urea.
| Compound Name | [1-(2-ethyl-3-oxopiperazin-1-yl)-4-methyl-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 63601168 |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | [1-(2-ethyl-3-oxopiperazin-1-yl)-4-methyl-1-oxopentan-2-yl]urea |
| SMILES | CCC1C(=O)NCCN1C(=O)C(CC(C)C)NC(N)=O |
| InChI | InChI=1S/C13H24N4O3/c1-4-10-11(18)15-5-6-17(10)12(19)9(7-8(2)3)16-13(14)20/h8-10H,4-7H2,1-3H3,(H,15,18)(H3,14,16,20) |
| InChIKey | QVOOWQJVUSYEGY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |