C8H15N3OS — CID 115617005
2-ethyl-N-methyl-3-oxopiperazine-1-carbothioamide (PubChem CID 115617005) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is 2-ethyl-N-methyl-3-oxopiperazine-1-carbothioamide.
| Compound Name | 2-ethyl-N-methyl-3-oxopiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 115617005 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-ethyl-N-methyl-3-oxopiperazine-1-carbothioamide |
| SMILES | CCC1C(=O)NCCN1C(=S)NC |
| InChI | InChI=1S/C8H15N3OS/c1-3-6-7(12)10-4-5-11(6)8(13)9-2/h6H,3-5H2,1-2H3,(H,9,13)(H,10,12) |
| InChIKey | IKCKMEUHPCYOIX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|