C13H21N3O5 — CID 115431256
2-[[(2,6-dioxopiperidin-3-yl)carbamoylamino]methyl]-2-ethylbutanoic acid (PubChem CID 115431256) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[[(2,6-dioxopiperidin-3-yl)carbamoylamino]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[(2,6-dioxopiperidin-3-yl)carbamoylamino]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 115431256 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-[[(2,6-dioxopiperidin-3-yl)carbamoylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CNC(=O)NC1CCC(=O)NC1=O)C(=O)O |
| InChI | InChI=1S/C13H21N3O5/c1-3-13(4-2,11(19)20)7-14-12(21)15-8-5-6-9(17)16-10(8)18/h8H,3-7H2,1-2H3,(H,19,20)(H2,14,15,21)(H,16,17,18) |
| InChIKey | FJRFUQAREBZAID-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|