C15H22N2O3 — CID 170777735
3-tert-butyl-N-(2,6-dioxopiperidin-3-yl)bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 170777735) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-tert-butyl-N-(2,6-dioxopiperidin-3-yl)bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | 3-tert-butyl-N-(2,6-dioxopiperidin-3-yl)bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 170777735 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-tert-butyl-N-(2,6-dioxopiperidin-3-yl)bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | CC(C)(C)C12CC(C(=O)NC3CCC(=O)NC3=O)(C1)C2 |
| InChI | InChI=1S/C15H22N2O3/c1-13(2,3)15-6-14(7-15,8-15)12(20)16-9-4-5-10(18)17-11(9)19/h9H,4-8H2,1-3H3,(H,16,20)(H,17,18,19) |
| InChIKey | JAZMFMSBAUWGQY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|