C17H22N2O3 — CID 170003318
5-tert-butyl-N-(2,6-dioxopiperidin-3-yl)cyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 170003318) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-tert-butyl-N-(2,6-dioxopiperidin-3-yl)cyclohepta-1,3,6-triene-1-carboxamide.
| Compound Name | 5-tert-butyl-N-(2,6-dioxopiperidin-3-yl)cyclohepta-1,3,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 170003318 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 5-tert-butyl-N-(2,6-dioxopiperidin-3-yl)cyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | CC(C)(C)C1C=CC=C(C(=O)NC2CCC(=O)NC2=O)C=C1 |
| InChI | InChI=1S/C17H22N2O3/c1-17(2,3)12-6-4-5-11(7-8-12)15(21)18-13-9-10-14(20)19-16(13)22/h4-8,12-13H,9-10H2,1-3H3,(H,18,21)(H,19,20,22) |
| InChIKey | HZNZHRGVYBIMRC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|