C14H20N2O3 — CID 177240315
(Z,3Z)-N-(2,6-dioxopiperidin-3-yl)-3-ethylidenehept-4-enamide (PubChem CID 177240315) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (Z,3Z)-N-(2,6-dioxopiperidin-3-yl)-3-ethylidenehept-4-enamide.
| Compound Name | (Z,3Z)-N-(2,6-dioxopiperidin-3-yl)-3-ethylidenehept-4-enamide |
|---|---|
| PubChem CID | 177240315 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (Z,3Z)-N-(2,6-dioxopiperidin-3-yl)-3-ethylidenehept-4-enamide |
| SMILES | C/C=C(\C=C/CC)CC(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H20N2O3/c1-3-5-6-10(4-2)9-13(18)15-11-7-8-12(17)16-14(11)19/h4-6,11H,3,7-9H2,1-2H3,(H,15,18)(H,16,17,19)/b6-5-,10-4+ |
| InChIKey | VCQLODAJZGXCKA-QYONPMAVSA-N |
| XLogP | 1.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|