C14H21N3O5S — CID 170009871
N-(2,6-dioxopiperidin-3-yl)-3-[[(2E,4Z)-hexa-2,4-dien-3-yl]sulfonylamino]propanamide (PubChem CID 170009871) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3-[[(2E,4Z)-hexa-2,4-dien-3-yl]sulfonylamino]propanamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3-[[(2E,4Z)-hexa-2,4-dien-3-yl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 170009871 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3-[[(2E,4Z)-hexa-2,4-dien-3-yl]sulfonylamino]propanamide |
| SMILES | C/C=C\C(=C/C)S(=O)(=O)NCCC(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H21N3O5S/c1-3-5-10(4-2)23(21,22)15-9-8-13(19)16-11-6-7-12(18)17-14(11)20/h3-5,11,15H,6-9H2,1-2H3,(H,16,19)(H,17,18,20)/b5-3-,10-4+ |
| InChIKey | JYTTZPFAUVEXMZ-FJQHFOHYSA-N |
| XLogP | -0.30 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|