C14H19N3O5S — CID 130441875
3-(cyclohexa-1,5-dien-1-ylsulfonylamino)-N-(2,6-dioxopiperidin-3-yl)propanamide (PubChem CID 130441875) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is 3-(cyclohexa-1,5-dien-1-ylsulfonylamino)-N-(2,6-dioxopiperidin-3-yl)propanamide.
| Compound Name | 3-(cyclohexa-1,5-dien-1-ylsulfonylamino)-N-(2,6-dioxopiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 130441875 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3-(cyclohexa-1,5-dien-1-ylsulfonylamino)-N-(2,6-dioxopiperidin-3-yl)propanamide |
| SMILES | O=C1CCC(NC(=O)CCNS(=O)(=O)C2=CCCC=C2)C(=O)N1 |
| InChI | InChI=1S/C14H19N3O5S/c18-12-7-6-11(14(20)17-12)16-13(19)8-9-15-23(21,22)10-4-2-1-3-5-10/h2,4-5,11,15H,1,3,6-9H2,(H,16,19)(H,17,18,20) |
| InChIKey | GKDKJOLRDSLTOU-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|