C15H19N3O6S — CID 163850796
N-(2,6-dioxopiperidin-3-yl)-3-[(4-methoxyphenyl)sulfonylamino]propanamide (PubChem CID 163850796) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3-[(4-methoxyphenyl)sulfonylamino]propanamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3-[(4-methoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 163850796 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3-[(4-methoxyphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(=O)NC2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C15H19N3O6S/c1-24-10-2-4-11(5-3-10)25(22,23)16-9-8-14(20)17-12-6-7-13(19)18-15(12)21/h2-5,12,16H,6-9H2,1H3,(H,17,20)(H,18,19,21) |
| InChIKey | OUECJYVCVSJVAA-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|