C16H20N2O5S — CID 154810812
N-(2,6-dioxopiperidin-3-yl)-4-(4-methylphenyl)sulfonylbutanamide (PubChem CID 154810812) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-4-(4-methylphenyl)sulfonylbutanamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-4-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 154810812 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-4-(4-methylphenyl)sulfonylbutanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCCC(=O)NC2CCC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c1-11-4-6-12(7-5-11)24(22,23)10-2-3-14(19)17-13-8-9-15(20)18-16(13)21/h4-7,13H,2-3,8-10H2,1H3,(H,17,19)(H,18,20,21) |
| InChIKey | QHZUPTHWZBIWSU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|