C18H24N2O4 — CID 154810739
2-(2-tert-butyl-4-methylphenoxy)-N-(2,6-dioxopiperidin-3-yl)acetamide (PubChem CID 154810739) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-methylphenoxy)-N-(2,6-dioxopiperidin-3-yl)acetamide.
| Compound Name | 2-(2-tert-butyl-4-methylphenoxy)-N-(2,6-dioxopiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 154810739 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-(2-tert-butyl-4-methylphenoxy)-N-(2,6-dioxopiperidin-3-yl)acetamide |
| SMILES | Cc1ccc(OCC(=O)NC2CCC(=O)NC2=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H24N2O4/c1-11-5-7-14(12(9-11)18(2,3)4)24-10-16(22)19-13-6-8-15(21)20-17(13)23/h5,7,9,13H,6,8,10H2,1-4H3,(H,19,22)(H,20,21,23) |
| InChIKey | CXAAFXYAMNLNRI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|