C25H31ClN2O3 — CID 108552692
2-(2-tert-butyl-4-methylphenoxy)-N-[1-(2-chlorobenzoyl)piperidin-4-yl]acetamide (PubChem CID 108552692) has the molecular formula C25H31ClN2O3 and a molecular weight of 442.99 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-methylphenoxy)-N-[1-(2-chlorobenzoyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(2-tert-butyl-4-methylphenoxy)-N-[1-(2-chlorobenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108552692 |
| Molecular Formula | C25H31ClN2O3 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-(2-tert-butyl-4-methylphenoxy)-N-[1-(2-chlorobenzoyl)piperidin-4-yl]acetamide |
| SMILES | Cc1ccc(OCC(=O)NC2CCN(C(=O)c3ccccc3Cl)CC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H31ClN2O3/c1-17-9-10-22(20(15-17)25(2,3)4)31-16-23(29)27-18-11-13-28(14-12-18)24(30)19-7-5-6-8-21(19)26/h5-10,15,18H,11-14,16H2,1-4H3,(H,27,29) |
| InChIKey | OWRFGHWLSCLRJD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |