C25H32N2O3 — CID 108535649
2-(2-tert-butyl-4-methylphenoxy)-1-[4-(2-methylbenzoyl)piperazin-1-yl]ethanone (PubChem CID 108535649) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-methylphenoxy)-1-[4-(2-methylbenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2-tert-butyl-4-methylphenoxy)-1-[4-(2-methylbenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108535649 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-(2-tert-butyl-4-methylphenoxy)-1-[4-(2-methylbenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(OCC(=O)N2CCN(C(=O)c3ccccc3C)CC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H32N2O3/c1-18-10-11-22(21(16-18)25(3,4)5)30-17-23(28)26-12-14-27(15-13-26)24(29)20-9-7-6-8-19(20)2/h6-11,16H,12-15,17H2,1-5H3 |
| InChIKey | WABDEHWCGPVTEG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |