C23H35ClN2O3 — CID 108564979
N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]-3-chloro-2,2-dimethylpropanamide (PubChem CID 108564979) has the molecular formula C23H35ClN2O3 and a molecular weight of 423.00 g/mol. Its IUPAC name is N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]-3-chloro-2,2-dimethylpropanamide.
| Compound Name | N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]-3-chloro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 108564979 |
| Molecular Formula | C23H35ClN2O3 |
| Molecular Weight | 423.00 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]-3-chloro-2,2-dimethylpropanamide |
| SMILES | Cc1ccc(OCC(=O)N2CCC(NC(=O)C(C)(C)CCl)CC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H35ClN2O3/c1-16-7-8-19(18(13-16)22(2,3)4)29-14-20(27)26-11-9-17(10-12-26)25-21(28)23(5,6)15-24/h7-8,13,17H,9-12,14-15H2,1-6H3,(H,25,28) |
| InChIKey | WVZXVYOEOGKUJE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.00 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|