C22H36N2O2 — CID 119560992
2-(2,4-ditert-butylphenoxy)-1-[4-(methylamino)piperidin-1-yl]ethanone (PubChem CID 119560992) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is 2-(2,4-ditert-butylphenoxy)-1-[4-(methylamino)piperidin-1-yl]ethanone.
| Compound Name | 2-(2,4-ditert-butylphenoxy)-1-[4-(methylamino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 119560992 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | 2-(2,4-ditert-butylphenoxy)-1-[4-(methylamino)piperidin-1-yl]ethanone |
| SMILES | CNC1CCN(C(=O)COc2ccc(C(C)(C)C)cc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H36N2O2/c1-21(2,3)16-8-9-19(18(14-16)22(4,5)6)26-15-20(25)24-12-10-17(23-7)11-13-24/h8-9,14,17,23H,10-13,15H2,1-7H3 |
| InChIKey | XYPLDSYMGRKBRS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |