C22H33NO4 — CID 54794261
1-[2-(2,4-ditert-butylphenoxy)acetyl]piperidine-3-carboxylic acid (PubChem CID 54794261) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is 1-[2-(2,4-ditert-butylphenoxy)acetyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-(2,4-ditert-butylphenoxy)acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54794261 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 1-[2-(2,4-ditert-butylphenoxy)acetyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(OCC(=O)N2CCCC(C(=O)O)C2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H33NO4/c1-21(2,3)16-9-10-18(17(12-16)22(4,5)6)27-14-19(24)23-11-7-8-15(13-23)20(25)26/h9-10,12,15H,7-8,11,13-14H2,1-6H3,(H,25,26) |
| InChIKey | OVCGUZFLOXLABK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |