C22H32N2O4 — CID 108564991
prop-2-enyl N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]carbamate (PubChem CID 108564991) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is prop-2-enyl N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]carbamate.
| Compound Name | prop-2-enyl N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108564991 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | prop-2-enyl N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]carbamate |
| SMILES | C=CCOC(=O)NC1CCN(C(=O)COc2ccc(C)cc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H32N2O4/c1-6-13-27-21(26)23-17-9-11-24(12-10-17)20(25)15-28-19-8-7-16(2)14-18(19)22(3,4)5/h6-8,14,17H,1,9-13,15H2,2-5H3,(H,23,26) |
| InChIKey | WUOJJPDNVIINBL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|