C26H34N2O4 — CID 108550337
N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]-3-methoxybenzamide (PubChem CID 108550337) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]-3-methoxybenzamide.
| Compound Name | N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 108550337 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | N-[1-[2-(2-tert-butyl-4-methylphenoxy)acetyl]piperidin-4-yl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC2CCN(C(=O)COc3ccc(C)cc3C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C26H34N2O4/c1-18-9-10-23(22(15-18)26(2,3)4)32-17-24(29)28-13-11-20(12-14-28)27-25(30)19-7-6-8-21(16-19)31-5/h6-10,15-16,20H,11-14,17H2,1-5H3,(H,27,30) |
| InChIKey | SPGYJTMFQVUJFG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |