C21H40N2O3 — CID 177318636
(Z,3Z)-N-(2,6-dioxopiperidin-3-yl)-3-ethylidene-5-methylhept-4-enamide;ethane (PubChem CID 177318636) has the molecular formula C21H40N2O3 and a molecular weight of 368.56 g/mol. Its IUPAC name is (Z,3Z)-N-(2,6-dioxopiperidin-3-yl)-3-ethylidene-5-methylhept-4-enamide;ethane.
| Compound Name | (Z,3Z)-N-(2,6-dioxopiperidin-3-yl)-3-ethylidene-5-methylhept-4-enamide;ethane |
|---|---|
| PubChem CID | 177318636 |
| Molecular Formula | C21H40N2O3 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | (Z,3Z)-N-(2,6-dioxopiperidin-3-yl)-3-ethylidene-5-methylhept-4-enamide;ethane |
| SMILES | C/C=C(\C=C(\C)CC)CC(=O)NC1CCC(=O)NC1=O.CC.CC.CC |
| InChI | InChI=1S/C15H22N2O3.3C2H6/c1-4-10(3)8-11(5-2)9-14(19)16-12-6-7-13(18)17-15(12)20;3*1-2/h5,8,12H,4,6-7,9H2,1-3H3,(H,16,19)(H,17,18,20);3*1-2H3/b10-8-,11-5+;;; |
| InChIKey | POUKFYXOZGPPHH-TWOWJKFXSA-N |
| XLogP | 4.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|