C19H32N2O3 — CID 176573991
(2E,4Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-5-methylhepta-2,4,6-trienamide;ethane (PubChem CID 176573991) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is (2E,4Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-5-methylhepta-2,4,6-trienamide;ethane.
| Compound Name | (2E,4Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-5-methylhepta-2,4,6-trienamide;ethane |
|---|---|
| PubChem CID | 176573991 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | (2E,4Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-5-methylhepta-2,4,6-trienamide;ethane |
| SMILES | C=C/C(C)=C\C=C(/CC)C(=O)NC1CCC(=O)NC1=O.CC.CC |
| InChI | InChI=1S/C15H20N2O3.2C2H6/c1-4-10(3)6-7-11(5-2)14(19)16-12-8-9-13(18)17-15(12)20;2*1-2/h4,6-7,12H,1,5,8-9H2,2-3H3,(H,16,19)(H,17,18,20);2*1-2H3/b10-6-,11-7+;; |
| InChIKey | MCEYIFCQFXRZSG-ZKEATHAOSA-N |
| XLogP | 3.43 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|