C14H21N2O3W- — CID 156866667
(2E)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidenepent-3-enamide;ethane;tungsten (PubChem CID 156866667) has the molecular formula C14H21N2O3W- and a molecular weight of 449.17 g/mol. Its IUPAC name is (2E)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidenepent-3-enamide;ethane;tungsten.
| Compound Name | (2E)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidenepent-3-enamide;ethane;tungsten |
|---|---|
| PubChem CID | 156866667 |
| Molecular Formula | C14H21N2O3W- |
| Molecular Weight | 449.17 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | (2E)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidenepent-3-enamide;ethane;tungsten |
| SMILES | C/C=[C-]/C(=C\C)C(=O)NC1CCC(=O)NC1=O.CC.[W] |
| InChI | InChI=1S/C12H15N2O3.C2H6.W/c1-3-5-8(4-2)11(16)13-9-6-7-10(15)14-12(9)17;1-2;/h3-4,9H,6-7H2,1-2H3,(H,13,16)(H,14,15,17);1-2H3;/q-1;;/b8-4+;; |
| InChIKey | NNPAKPDOINNISU-ZDTICIBISA-N |
| XLogP | 1.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|