C15H25FN2O3 — CID 153385187
(3Z,5E)-N-(2,6-dioxopiperidin-3-yl)-6-fluoro-2-methylidenehepta-3,5-dienamide;ethane;molecular hydrogen (PubChem CID 153385187) has the molecular formula C15H25FN2O3 and a molecular weight of 300.37 g/mol. Its IUPAC name is (3Z,5E)-N-(2,6-dioxopiperidin-3-yl)-6-fluoro-2-methylidenehepta-3,5-dienamide;ethane;molecular hydrogen.
| Compound Name | (3Z,5E)-N-(2,6-dioxopiperidin-3-yl)-6-fluoro-2-methylidenehepta-3,5-dienamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 153385187 |
| Molecular Formula | C15H25FN2O3 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (3Z,5E)-N-(2,6-dioxopiperidin-3-yl)-6-fluoro-2-methylidenehepta-3,5-dienamide;ethane;molecular hydrogen |
| SMILES | C=C(/C=C\C=C(/C)F)C(=O)NC1CCC(=O)NC1=O.CC.[H][H].[H][H] |
| InChI | InChI=1S/C13H15FN2O3.C2H6.2H2/c1-8(4-3-5-9(2)14)12(18)15-10-6-7-11(17)16-13(10)19;1-2;;/h3-5,10H,1,6-7H2,2H3,(H,15,18)(H,16,17,19);1-2H3;2*1H/b4-3-,9-5+;;; |
| InChIKey | UJPKBFNHWJFWLX-HTMWJHCYSA-N |
| XLogP | 2.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|