C21H21FN4O4 — CID 167288450
(Z)-N-(2,6-dioxopiperidin-3-yl)-5-[3-(5-fluoro-2-pyridinyl)prop-2-ynoylamino]-5-methyl-2-methylidenehex-3-enamide (PubChem CID 167288450) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is (Z)-N-(2,6-dioxopiperidin-3-yl)-5-[3-(5-fluoro-2-pyridinyl)prop-2-ynoylamino]-5-methyl-2-methylidenehex-3-enamide.
| Compound Name | (Z)-N-(2,6-dioxopiperidin-3-yl)-5-[3-(5-fluoro-2-pyridinyl)prop-2-ynoylamino]-5-methyl-2-methylidenehex-3-enamide |
|---|---|
| PubChem CID | 167288450 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (Z)-N-(2,6-dioxopiperidin-3-yl)-5-[3-(5-fluoro-2-pyridinyl)prop-2-ynoylamino]-5-methyl-2-methylidenehex-3-enamide |
| SMILES | C=C(/C=C\C(C)(C)NC(=O)C#Cc1ccc(F)cn1)C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C21H21FN4O4/c1-13(19(29)24-16-7-9-17(27)25-20(16)30)10-11-21(2,3)26-18(28)8-6-15-5-4-14(22)12-23-15/h4-5,10-12,16H,1,7,9H2,2-3H3,(H,24,29)(H,26,28)(H,25,27,30)/b11-10- |
| InChIKey | XXBVCPRGPQTBJR-KHPPLWFESA-N |
| XLogP | 0.50 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|